KielieCooper KielieCooper

07-11-2022
Mathematics

contestada

tan(x+pie) + sin(x+pie) + sin (x-pie) = 0

Respuesta :

emmymaster3 emmymaster3

07-11-2022

Answer:Use the identity: sin(A+B) = sin(A)cos(B)+cos(A)sin(B) Substitute x for A and pi for B: sin(x+pi) = sin(x)cos(pi)+cos(x)sin(pi) The second term disappears, ...

Step-by-step explanation:

Answer Link

Otras preguntas

What was the most significant result of the ruling in Marbury vs madison

what is forensic neuropsychology?

List four possible methods for sterilizing ballast

Whats the start time for 10:08

What literary device is the phrase sword-feast? A- Alliteration B- kenning C- characterization D-Exposition

3. What line forms when a plane and a cylinder intersect?

que es un acento diacritico

Jane was very upset when she discovered that her aunt was suffering from asthma. She now wants to help reduce air pollution in her area. Which action will best

molecular evidence that led to the three domain system of classification

which statement describes the views of the democratic republican party?