jejeksks jejeksks

06-02-2021
History

contestada

5. Sinclair's book led to which act in 1906 prohibiting the manufacture, sale, or shipping
of impure or falsely labeled food and drug?
A. The Sherman Antitrust Act
B. The Gospel of Wealth
C. Prohibition
D. The Pure Food and Drug Act

Respuesta :

Analia1234 Analia1234

06-02-2021

Answer: The Pure Food and Drug Act of 1906

Answer Link

Otras preguntas

Why is the survey considered pseudoscience? The data are objective It involves a collection of facts It involves a collection of opinions The data are cons

Find the value of x if this is a rectangle.

what does this meaan if yuo dont use google translate plese dont or u wont get points ڪتي جو کاڌو does it mean hello? hmmm........

Help to solve this question, thanks

In the following picture, (QS) ̅ and (PR) ̅ are chords of the circle. Find the length of QS. (Remember to show formulas/equations and numbers in those formulas/

Original price $120 discount 36% what’s the sales price?

Help me with the answer

Which situation is the BEST example of inertia?

Thank you in advance for the help !!!

simplify the expression using sum or difference identities cos(12)cos(-3)-sin(12)sin(-3)