abbyyy55 abbyyy55
  • 10-09-2016
  • Mathematics
contestada

What is 5/6mn-7/8mn? Explain how you got it

Respuesta :

bahua
bahua bahua
  • 10-09-2016
-1/24 is that true?????????
Answer Link

Otras preguntas

1B ✓ 1C ✓ 1D 1E ✓ Bookwork code: 1F X 1F State whether each of the statements below is true or false. a) (40 × 4) × 2 = 40 × (4 × b) (40+ 4) + 2 = 40 + (4 + 2)
The purchase order drives the _____ for each business transaction.
شمال کےپہاڈی علاقوں سے کراچی تک خوبصورت مناظر کاایک طویل سلسلہ ہے۔یہاں خوبصورت جھیلیں اور دنیا کی بلند ترین چوٹیاں ہیں۔عظیم دریائے سندھ بھی اس کے وسیع میدانوں ک
I have some big news: in love! (I / fall)
What were the inherent causes of the American Revolution
3 C2H3O2H+Al(OH)3-Al(C2H3O2)3+H2O Determine the mass of aluminum acetated that can be made if this reaction with 125 grams of acetic acid and 275 gram of alumin
8 വരികളിൽ സൗഹൃദത്തെക്കുറിച്ച് ഒരു കവിത എഴുതുക
vectors - can anyone help me with 4c only and explain how to do it please!!! i’ve been set it as homework but we haven’t covered it at school
Which reactions are involved in the process of photosyenthesis
Suppose that A,B and C represent 1,2 and 3 in some order. What is the largest possible sum that can result from this addition ABC4 5ABC +CB6A