kasha04 kasha04

10-05-2020
Chemistry

contestada

In the science lab, Sika combines two substances and determines that a chemical change has taken place. What
evidence might she have based this on?

Respuesta :

applechunks applechunks

10-05-2020

Answer:

Evidence of chemical change is color change, smell,new matter created, gas created or heat or light being created.

Explanation:

Answer Link

Otras preguntas

The acceleration due to gravity on earth is 9.8m/s2. What is the weight of a 75 kg person on earth? a. 9.8 NB. 75 NC. 85 N d. 735 N

What is this answer??

Use an appropriate identity to find the exact value of the expression. cos(310)cos(50)-sin(310)sin(50)

Authors like Ernest Hemingway and F. Scott Fitzgerald often wrote and reflected on what event?

Without computing each sum, find which is greater, O or E, and by how much. O=3+5+7+9+...+105 E=2+4+6+8+...+104

The influence of Greek and roman culture on some renaissance art is reflected in

4(x + 3) ≤ 0 or 1/4 x + 1 > 3

How far did antarctica extent during the last ice age?

A cube has side length aa. The side lengths are decreased to 20% of their original size. Write an expression in simplest form for the volume of the new cube in

The questions "who" "where" and "how" can be used to