marinasosa marinasosa

09-02-2018
Computers and Technology

contestada

When you use basic search strategies to find information on the Internet, you should _____ before using a search engine.

Respuesta :

grace072702 grace072702

09-02-2018

form your search question carefully and identify the keywords.

Answer Link

mosravo mosravo

03-12-2019

Answer:

Form and combine all search questions, key words, terms and phrases in order to retrieve accurate results.

Explanation:

Answer Link

Otras preguntas

5. What will $82,000 grow to be in 11 years if it is invested today at 8% and the interest rate is compounded monthly?

The equation of a line is y-17=6x. What is the y-intercept of this line

COMMON CORE EGDENUTY BIOLOGYSo the question is basically to Explore the presence of nutrients in food using a laboratory experiment and deductivereasoning. Some

slope-intercept graphs I need to know witch number I’m supposed to graph for example like (0,0)

Find the volume of a cone that has a radius of 3 inches and the height of 4 inches

3 C2H3O2H+Al(OH)3-Al(C2H3O2)3+H2O Determine the mass of aluminum acetated that can be made if this reaction with 125 grams of acetic acid and 275 gram of alumin

Compound Heterogeneous Metalloidn X-Pure substance, Y Mixtures, A-Homogeneous mixtures, C. Non-metals, E. Noble gases. 2JX-Non-metals, Y-Mixtures, A-Homogeneous

How many angles x in the set [0, 2pi] satisfy the equation sin x + sin 3x = -cos x + cos 3x?

COMMON CORE EGDENUTY BIOLOGYSo the question is basically to Explore the presence of nutrients in food using a laboratory experiment and deductivereasoning. Some

Explain the geometric approach to differentiation?